C17H21NO5 — CID 71512342
benzyl (2S)-2-[(E,1R)-1-hydroxy-4-methoxy-4-oxobut-2-enyl]pyrrolidine-1-carboxylate (PubChem CID 71512342) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is benzyl (2S)-2-[(E,1R)-1-hydroxy-4-methoxy-4-oxobut-2-enyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-[(E,1R)-1-hydroxy-4-methoxy-4-oxobut-2-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71512342 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | benzyl (2S)-2-[(E,1R)-1-hydroxy-4-methoxy-4-oxobut-2-enyl]pyrrolidine-1-carboxylate |
| SMILES | COC(=O)/C=C/[C@@H](O)[C@@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H21NO5/c1-22-16(20)10-9-15(19)14-8-5-11-18(14)17(21)23-12-13-6-3-2-4-7-13/h2-4,6-7,9-10,14-15,19H,5,8,11-12H2,1H3/b10-9+/t14-,15+/m0/s1 |
| InChIKey | WYUOWXUCUGASLS-LWLVDVGCSA-N |
| XLogP | 1.88 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|