C17H23NO4 — CID 86319274
benzyl (2S)-2-(2-ethoxy-2-oxoethyl)piperidine-1-carboxylate (PubChem CID 86319274) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is benzyl (2S)-2-(2-ethoxy-2-oxoethyl)piperidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-(2-ethoxy-2-oxoethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86319274 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | benzyl (2S)-2-(2-ethoxy-2-oxoethyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)C[C@@H]1CCCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c1-2-21-16(19)12-15-10-6-7-11-18(15)17(20)22-13-14-8-4-3-5-9-14/h3-5,8-9,15H,2,6-7,10-13H2,1H3/t15-/m0/s1 |
| InChIKey | DJNAOSVXYDYKKU-HNNXBMFYSA-N |
| XLogP | 3.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |