C19H25NO4 — CID 139725156
benzyl (2R)-2-(2-ethoxycarbonylbut-1-enyl)pyrrolidine-1-carboxylate (PubChem CID 139725156) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is benzyl (2R)-2-(2-ethoxycarbonylbut-1-enyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-(2-ethoxycarbonylbut-1-enyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139725156 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | benzyl (2R)-2-(2-ethoxycarbonylbut-1-enyl)pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)C(=C[C@H]1CCCN1C(=O)OCc1ccccc1)CC |
| InChI | InChI=1S/C19H25NO4/c1-3-16(18(21)23-4-2)13-17-11-8-12-20(17)19(22)24-14-15-9-6-5-7-10-15/h5-7,9-10,13,17H,3-4,8,11-12,14H2,1-2H3/t17-/m1/s1 |
| InChIKey | RSWQTOQARNTQRO-QGZVFWFLSA-N |
| XLogP | 3.69 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|