C17H19NO4 — CID 10924612
benzyl (2S)-2-(3-ethoxy-3-oxoprop-1-ynyl)pyrrolidine-1-carboxylate (PubChem CID 10924612) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is benzyl (2S)-2-(3-ethoxy-3-oxoprop-1-ynyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-(3-ethoxy-3-oxoprop-1-ynyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10924612 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | benzyl (2S)-2-(3-ethoxy-3-oxoprop-1-ynyl)pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)C#C[C@@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H19NO4/c1-2-21-16(19)11-10-15-9-6-12-18(15)17(20)22-13-14-7-4-3-5-8-14/h3-5,7-8,15H,2,6,9,12-13H2,1H3/t15-/m0/s1 |
| InChIKey | DBVYFMONFYNHKI-HNNXBMFYSA-N |
| XLogP | 2.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|