C15H17NO2 — CID 11042949
ethyl 2-(2-phenylethynyl)pyrrolidine-1-carboxylate (PubChem CID 11042949) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is ethyl 2-(2-phenylethynyl)pyrrolidine-1-carboxylate.
| Compound Name | ethyl 2-(2-phenylethynyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11042949 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | ethyl 2-(2-phenylethynyl)pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC1C#Cc1ccccc1 |
| InChI | InChI=1S/C15H17NO2/c1-2-18-15(17)16-12-6-9-14(16)11-10-13-7-4-3-5-8-13/h3-5,7-8,14H,2,6,9,12H2,1H3 |
| InChIKey | CKAVLRZLIMZCJK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|