C11H15NO2S — CID 95358480
ethyl (2R)-2-thiophen-2-ylpyrrolidine-1-carboxylate (PubChem CID 95358480) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is ethyl (2R)-2-thiophen-2-ylpyrrolidine-1-carboxylate.
| Compound Name | ethyl (2R)-2-thiophen-2-ylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 95358480 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | ethyl (2R)-2-thiophen-2-ylpyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C11H15NO2S/c1-2-14-11(13)12-7-3-5-9(12)10-6-4-8-15-10/h4,6,8-9H,2-3,5,7H2,1H3/t9-/m1/s1 |
| InChIKey | HJKGHVBJHCUNNG-SECBINFHSA-N |
| XLogP | 3.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |