C13H18ClNOS — CID 63679619
3-chloro-2,2-dimethyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)propan-1-one (PubChem CID 63679619) has the molecular formula C13H18ClNOS and a molecular weight of 271.81 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)propan-1-one.
| Compound Name | 3-chloro-2,2-dimethyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 63679619 |
| Molecular Formula | C13H18ClNOS |
| Molecular Weight | 271.81 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-chloro-2,2-dimethyl-1-(2-thiophen-2-ylpyrrolidin-1-yl)propan-1-one |
| SMILES | CC(C)(CCl)C(=O)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C13H18ClNOS/c1-13(2,9-14)12(16)15-7-3-5-10(15)11-6-4-8-17-11/h4,6,8,10H,3,5,7,9H2,1-2H3 |
| InChIKey | MNHWCBFEPBYDAN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.81 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|