C12H15NOS2 — CID 145108412
2,2-dimethyl-3-oxo-3-(2-thiophen-2-ylazetidin-1-yl)propanethial (PubChem CID 145108412) has the molecular formula C12H15NOS2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 2,2-dimethyl-3-oxo-3-(2-thiophen-2-ylazetidin-1-yl)propanethial.
| Compound Name | 2,2-dimethyl-3-oxo-3-(2-thiophen-2-ylazetidin-1-yl)propanethial |
|---|---|
| PubChem CID | 145108412 |
| Molecular Formula | C12H15NOS2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2,2-dimethyl-3-oxo-3-(2-thiophen-2-ylazetidin-1-yl)propanethial |
| SMILES | CC(C)(C=S)C(=O)N1CCC1c1cccs1 |
| InChI | InChI=1S/C12H15NOS2/c1-12(2,8-15)11(14)13-6-5-9(13)10-4-3-7-16-10/h3-4,7-9H,5-6H2,1-2H3 |
| InChIKey | FYYLSUHNEZZOAK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|