C12H19NOS2 — CID 67330407
(2R)-1-tert-butylsulfinyl-2-thiophen-2-ylpyrrolidine (PubChem CID 67330407) has the molecular formula C12H19NOS2 and a molecular weight of 257.42 g/mol. Its IUPAC name is (2R)-1-tert-butylsulfinyl-2-thiophen-2-ylpyrrolidine.
| Compound Name | (2R)-1-tert-butylsulfinyl-2-thiophen-2-ylpyrrolidine |
|---|---|
| PubChem CID | 67330407 |
| Molecular Formula | C12H19NOS2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (2R)-1-tert-butylsulfinyl-2-thiophen-2-ylpyrrolidine |
| SMILES | CC(C)(C)S(=O)N1CCC[C@@H]1c1cccs1 |
| InChI | InChI=1S/C12H19NOS2/c1-12(2,3)16(14)13-8-4-6-10(13)11-7-5-9-15-11/h5,7,9-10H,4,6,8H2,1-3H3/t10-,16?/m1/s1 |
| InChIKey | UAUSENBMSZCPSH-HQNRFAHOSA-N |
| XLogP | 3.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |