C14H21NOS — CID 11242184
(2R)-1-[(S)-tert-butylsulfinyl]-2-phenylpyrrolidine (PubChem CID 11242184) has the molecular formula C14H21NOS and a molecular weight of 251.40 g/mol. Its IUPAC name is (2R)-1-[(S)-tert-butylsulfinyl]-2-phenylpyrrolidine.
| Compound Name | (2R)-1-[(S)-tert-butylsulfinyl]-2-phenylpyrrolidine |
|---|---|
| PubChem CID | 11242184 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (2R)-1-[(S)-tert-butylsulfinyl]-2-phenylpyrrolidine |
| SMILES | CC(C)(C)[S@](=O)N1CCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H21NOS/c1-14(2,3)17(16)15-11-7-10-13(15)12-8-5-4-6-9-12/h4-6,8-9,13H,7,10-11H2,1-3H3/t13-,17+/m1/s1 |
| InChIKey | VMJKXCDBADVWLN-DYVFJYSZSA-N |
| XLogP | 3.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |