C15H21F2NO2S — CID 178095116
(2R)-1-[(R)-tert-butylsulfinyl]-2-[3-(difluoromethoxy)phenyl]pyrrolidine (PubChem CID 178095116) has the molecular formula C15H21F2NO2S and a molecular weight of 317.40 g/mol. Its IUPAC name is (2R)-1-[(R)-tert-butylsulfinyl]-2-[3-(difluoromethoxy)phenyl]pyrrolidine.
| Compound Name | (2R)-1-[(R)-tert-butylsulfinyl]-2-[3-(difluoromethoxy)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 178095116 |
| Molecular Formula | C15H21F2NO2S |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (2R)-1-[(R)-tert-butylsulfinyl]-2-[3-(difluoromethoxy)phenyl]pyrrolidine |
| SMILES | CC(C)(C)[S@@](=O)N1CCC[C@@H]1c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H21F2NO2S/c1-15(2,3)21(19)18-9-5-8-13(18)11-6-4-7-12(10-11)20-14(16)17/h4,6-7,10,13-14H,5,8-9H2,1-3H3/t13-,21-/m1/s1 |
| InChIKey | SUFAVFWYMURDRX-LRTDBIEQSA-N |
| XLogP | 3.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |