C16H23NO3 — CID 15189984
tert-butyl 2-(3-methoxyphenyl)pyrrolidine-1-carboxylate (PubChem CID 15189984) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is tert-butyl 2-(3-methoxyphenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(3-methoxyphenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15189984 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | tert-butyl 2-(3-methoxyphenyl)pyrrolidine-1-carboxylate |
| SMILES | COc1cccc(C2CCCN2C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C16H23NO3/c1-16(2,3)20-15(18)17-10-6-9-14(17)12-7-5-8-13(11-12)19-4/h5,7-8,11,14H,6,9-10H2,1-4H3 |
| InChIKey | QBCHZWMMVIICFT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |