C18H29NO2Si — CID 71207301
tert-butyl 2-(3-trimethylsilylphenyl)pyrrolidine-1-carboxylate (PubChem CID 71207301) has the molecular formula C18H29NO2Si and a molecular weight of 319.52 g/mol. Its IUPAC name is tert-butyl 2-(3-trimethylsilylphenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(3-trimethylsilylphenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 71207301 |
| Molecular Formula | C18H29NO2Si |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | tert-butyl 2-(3-trimethylsilylphenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1cccc([Si](C)(C)C)c1 |
| InChI | InChI=1S/C18H29NO2Si/c1-18(2,3)21-17(20)19-12-8-11-16(19)14-9-7-10-15(13-14)22(4,5)6/h7,9-10,13,16H,8,11-12H2,1-6H3 |
| InChIKey | MJQBJXPHXNPCQP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|