C16H22BrNO2 — CID 53419960
tert-butyl 2-(4-bromo-3-methylphenyl)pyrrolidine-1-carboxylate (PubChem CID 53419960) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is tert-butyl 2-(4-bromo-3-methylphenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-bromo-3-methylphenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 53419960 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | tert-butyl 2-(4-bromo-3-methylphenyl)pyrrolidine-1-carboxylate |
| SMILES | Cc1cc(C2CCCN2C(=O)OC(C)(C)C)ccc1Br |
| InChI | InChI=1S/C16H22BrNO2/c1-11-10-12(7-8-13(11)17)14-6-5-9-18(14)15(19)20-16(2,3)4/h7-8,10,14H,5-6,9H2,1-4H3 |
| InChIKey | VQDKQGKKKXBVMS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |