C15H20BrNO2 — CID 86332501
tert-butyl (2R)-2-(3-bromophenyl)pyrrolidine-1-carboxylate (PubChem CID 86332501) has the molecular formula C15H20BrNO2 and a molecular weight of 326.23 g/mol. Its IUPAC name is tert-butyl (2R)-2-(3-bromophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-(3-bromophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 86332501 |
| Molecular Formula | C15H20BrNO2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | tert-butyl (2R)-2-(3-bromophenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1c1cccc(Br)c1 |
| InChI | InChI=1S/C15H20BrNO2/c1-15(2,3)19-14(18)17-9-5-8-13(17)11-6-4-7-12(16)10-11/h4,6-7,10,13H,5,8-9H2,1-3H3/t13-/m1/s1 |
| InChIKey | JNCUUJFKWXBYTB-CYBMUJFWSA-N |
| XLogP | 4.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |