C15H19BrFNO2 — CID 53419955
tert-butyl 2-(4-bromo-2-fluorophenyl)pyrrolidine-1-carboxylate (PubChem CID 53419955) has the molecular formula C15H19BrFNO2 and a molecular weight of 344.22 g/mol. Its IUPAC name is tert-butyl 2-(4-bromo-2-fluorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-bromo-2-fluorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 53419955 |
| Molecular Formula | C15H19BrFNO2 |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | tert-butyl 2-(4-bromo-2-fluorophenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1ccc(Br)cc1F |
| InChI | InChI=1S/C15H19BrFNO2/c1-15(2,3)20-14(19)18-8-4-5-13(18)11-7-6-10(16)9-12(11)17/h6-7,9,13H,4-5,8H2,1-3H3 |
| InChIKey | QTHKVXCTSVSLEO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |