C18H29NO2 — CID 144843357
tert-butyl 2-(2-methylphenyl)pyrrolidine-1-carboxylate;ethane (PubChem CID 144843357) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is tert-butyl 2-(2-methylphenyl)pyrrolidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 2-(2-methylphenyl)pyrrolidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 144843357 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | tert-butyl 2-(2-methylphenyl)pyrrolidine-1-carboxylate;ethane |
| SMILES | CC.Cc1ccccc1C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23NO2.C2H6/c1-12-8-5-6-9-13(12)14-10-7-11-17(14)15(18)19-16(2,3)4;1-2/h5-6,8-9,14H,7,10-11H2,1-4H3;1-2H3 |
| InChIKey | LYFWWUYUCUMRII-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |