C18H27NO2 — CID 155600402
tert-butyl 2-(2-propan-2-ylphenyl)pyrrolidine-1-carboxylate (PubChem CID 155600402) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is tert-butyl 2-(2-propan-2-ylphenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2-propan-2-ylphenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155600402 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | tert-butyl 2-(2-propan-2-ylphenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)c1ccccc1C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO2/c1-13(2)14-9-6-7-10-15(14)16-11-8-12-19(16)17(20)21-18(3,4)5/h6-7,9-10,13,16H,8,11-12H2,1-5H3 |
| InChIKey | PAQGPYGXFINLCX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |