C21H24FN3O3 — CID 102410009
tert-butyl (2R)-2-[2-fluoro-4-(pyridine-2-carbonylamino)phenyl]pyrrolidine-1-carboxylate (PubChem CID 102410009) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is tert-butyl (2R)-2-[2-fluoro-4-(pyridine-2-carbonylamino)phenyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[2-fluoro-4-(pyridine-2-carbonylamino)phenyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102410009 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | tert-butyl (2R)-2-[2-fluoro-4-(pyridine-2-carbonylamino)phenyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1c1ccc(NC(=O)c2ccccn2)cc1F |
| InChI | InChI=1S/C21H24FN3O3/c1-21(2,3)28-20(27)25-12-6-8-18(25)15-10-9-14(13-16(15)22)24-19(26)17-7-4-5-11-23-17/h4-5,7,9-11,13,18H,6,8,12H2,1-3H3,(H,24,26)/t18-/m1/s1 |
| InChIKey | CPRGJZYOHIGICQ-GOSISDBHSA-N |
| XLogP | 4.55 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |