C15H19Cl2NO2 — CID 65142557
tert-butyl 2-(3,4-dichlorophenyl)pyrrolidine-1-carboxylate (PubChem CID 65142557) has the molecular formula C15H19Cl2NO2 and a molecular weight of 316.23 g/mol. Its IUPAC name is tert-butyl 2-(3,4-dichlorophenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(3,4-dichlorophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 65142557 |
| Molecular Formula | C15H19Cl2NO2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | tert-butyl 2-(3,4-dichlorophenyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2NO2/c1-15(2,3)20-14(19)18-8-4-5-13(18)10-6-7-11(16)12(17)9-10/h6-7,9,13H,4-5,8H2,1-3H3 |
| InChIKey | NCWODKJBDADTIR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |