C22H32N2O4 — CID 51325156
tert-butyl 4-[2-(3-methoxyphenyl)pyrrolidine-1-carbonyl]piperidine-1-carboxylate (PubChem CID 51325156) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is tert-butyl 4-[2-(3-methoxyphenyl)pyrrolidine-1-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3-methoxyphenyl)pyrrolidine-1-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 51325156 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | tert-butyl 4-[2-(3-methoxyphenyl)pyrrolidine-1-carbonyl]piperidine-1-carboxylate |
| SMILES | COc1cccc(C2CCCN2C(=O)C2CCN(C(=O)OC(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C22H32N2O4/c1-22(2,3)28-21(26)23-13-10-16(11-14-23)20(25)24-12-6-9-19(24)17-7-5-8-18(15-17)27-4/h5,7-8,15-16,19H,6,9-14H2,1-4H3 |
| InChIKey | GLCBMUSUQQCWAU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |