C16H25NO2S — CID 164673653
(2R)-1-[(R)-tert-butylsulfinyl]-2-(4-methoxyphenyl)piperidine (PubChem CID 164673653) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is (2R)-1-[(R)-tert-butylsulfinyl]-2-(4-methoxyphenyl)piperidine.
| Compound Name | (2R)-1-[(R)-tert-butylsulfinyl]-2-(4-methoxyphenyl)piperidine |
|---|---|
| PubChem CID | 164673653 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | (2R)-1-[(R)-tert-butylsulfinyl]-2-(4-methoxyphenyl)piperidine |
| SMILES | COc1ccc([C@H]2CCCCN2[S@](=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H25NO2S/c1-16(2,3)20(18)17-12-6-5-7-15(17)13-8-10-14(19-4)11-9-13/h8-11,15H,5-7,12H2,1-4H3/t15-,20-/m1/s1 |
| InChIKey | ZSASPUYMZSKPIO-FOIQADDNSA-N |
| XLogP | 3.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |