C15H20N2O2S — CID 71728991
3-[(2R)-1-tert-butylsulfinylpyrrolidin-2-yl]-1,2-benzoxazole (PubChem CID 71728991) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is 3-[(2R)-1-tert-butylsulfinylpyrrolidin-2-yl]-1,2-benzoxazole.
| Compound Name | 3-[(2R)-1-tert-butylsulfinylpyrrolidin-2-yl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 71728991 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-[(2R)-1-tert-butylsulfinylpyrrolidin-2-yl]-1,2-benzoxazole |
| SMILES | CC(C)(C)S(=O)N1CCC[C@@H]1c1noc2ccccc12 |
| InChI | InChI=1S/C15H20N2O2S/c1-15(2,3)20(18)17-10-6-8-12(17)14-11-7-4-5-9-13(11)19-16-14/h4-5,7,9,12H,6,8,10H2,1-3H3/t12-,20?/m1/s1 |
| InChIKey | XGWHYCWTRKVMCO-ZRIYNBNISA-N |
| XLogP | 3.43 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |