C18H22N2O3 — CID 20707055
3-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]pentane-2,4-dione (PubChem CID 20707055) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]pentane-2,4-dione.
| Compound Name | 3-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 20707055 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 3-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]pentane-2,4-dione |
| SMILES | CC(=O)C(CN1CCC(c2noc3ccccc23)CC1)C(C)=O |
| InChI | InChI=1S/C18H22N2O3/c1-12(21)16(13(2)22)11-20-9-7-14(8-10-20)18-15-5-3-4-6-17(15)23-19-18/h3-6,14,16H,7-11H2,1-2H3 |
| InChIKey | ZQGPGOKJVCCDST-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|