C19H18N2O3 — CID 13078339
[4-(1,2-benzoxazol-3-yl)piperidin-1-yl] benzoate (PubChem CID 13078339) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is [4-(1,2-benzoxazol-3-yl)piperidin-1-yl] benzoate.
| Compound Name | [4-(1,2-benzoxazol-3-yl)piperidin-1-yl] benzoate |
|---|---|
| PubChem CID | 13078339 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [4-(1,2-benzoxazol-3-yl)piperidin-1-yl] benzoate |
| SMILES | O=C(ON1CCC(c2noc3ccccc23)CC1)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O3/c22-19(15-6-2-1-3-7-15)24-21-12-10-14(11-13-21)18-16-8-4-5-9-17(16)23-20-18/h1-9,14H,10-13H2 |
| InChIKey | BMWDKNJLXMCLEF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |