C19H22N4O2 — CID 142644427
3-[1-(3-pyrimidin-2-yloxypropyl)piperidin-4-yl]-1,2-benzoxazole (PubChem CID 142644427) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-[1-(3-pyrimidin-2-yloxypropyl)piperidin-4-yl]-1,2-benzoxazole.
| Compound Name | 3-[1-(3-pyrimidin-2-yloxypropyl)piperidin-4-yl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 142644427 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 3-[1-(3-pyrimidin-2-yloxypropyl)piperidin-4-yl]-1,2-benzoxazole |
| SMILES | c1cnc(OCCCN2CCC(c3noc4ccccc34)CC2)nc1 |
| InChI | InChI=1S/C19H22N4O2/c1-2-6-17-16(5-1)18(22-25-17)15-7-12-23(13-8-15)11-4-14-24-19-20-9-3-10-21-19/h1-3,5-6,9-10,15H,4,7-8,11-14H2 |
| InChIKey | MIHZJZLEBACDGH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|