C20H29N3OS — CID 167189702
3-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]-N-ethyl-N-prop-1-en-2-ylsulfanylpropan-1-amine (PubChem CID 167189702) has the molecular formula C20H29N3OS and a molecular weight of 359.54 g/mol. Its IUPAC name is 3-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]-N-ethyl-N-prop-1-en-2-ylsulfanylpropan-1-amine.
| Compound Name | 3-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]-N-ethyl-N-prop-1-en-2-ylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 167189702 |
| Molecular Formula | C20H29N3OS |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 3-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]-N-ethyl-N-prop-1-en-2-ylsulfanylpropan-1-amine |
| SMILES | C=C(C)SN(CC)CCCN1CCC(c2noc3ccccc23)CC1 |
| InChI | InChI=1S/C20H29N3OS/c1-4-23(25-16(2)3)13-7-12-22-14-10-17(11-15-22)20-18-8-5-6-9-19(18)24-21-20/h5-6,8-9,17H,2,4,7,10-15H2,1,3H3 |
| InChIKey | XDUKJATXYPKGBQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|