C26H35N3O9 — CID 70410215
2-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]-N,N-diethylethanamine;bis(but-2-enedioic acid) (PubChem CID 70410215) has the molecular formula C26H35N3O9 and a molecular weight of 533.58 g/mol. Its IUPAC name is 2-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]-N,N-diethylethanamine;bis(but-2-enedioic acid).
| Compound Name | 2-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]-N,N-diethylethanamine;bis(but-2-enedioic acid) |
|---|---|
| PubChem CID | 70410215 |
| Molecular Formula | C26H35N3O9 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 2-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]-N,N-diethylethanamine;bis(but-2-enedioic acid) |
| SMILES | CCN(CC)CCN1CCC(c2noc3ccccc23)CC1.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C18H27N3O.2C4H4O4/c1-3-20(4-2)13-14-21-11-9-15(10-12-21)18-16-7-5-6-8-17(16)22-19-18;2*5-3(6)1-2-4(7)8/h5-8,15H,3-4,9-14H2,1-2H3;2*1-2H,(H,5,6)(H,7,8) |
| InChIKey | SVSLGDLAWNRNLC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 181.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|