C15H19ClN2O — CID 13076451
3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride (PubChem CID 13076451) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride.
| Compound Name | 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride |
|---|---|
| PubChem CID | 13076451 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride |
| SMILES | C=CCN1CCC(c2noc3ccccc23)CC1.Cl |
| InChI | InChI=1S/C15H18N2O.ClH/c1-2-9-17-10-7-12(8-11-17)15-13-5-3-4-6-14(13)18-16-15;/h2-6,12H,1,7-11H2;1H |
| InChIKey | XJLHPZCWMVWAQR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|