About 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride
3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride (PubChem CID 13076451) has the molecular formula C15H19ClN2O
and a molecular weight of 278.78 g/mol. Its IUPAC name is 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride.
Molecular Properties
| Compound Name | 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride |
| PubChem CID | 13076451 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride |
| SMILES | C=CCN1CCC(c2noc3ccccc23)CC1.Cl |
| InChI | InChI=1S/C15H18N2O.ClH/c1-2-9-17-10-7-12(8-11-17)15-13-5-3-4-6-14(13)18-16-15;/h2-6,12H,1,7-11H2;1H |
| InChIKey | XJLHPZCWMVWAQR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride?
The IUPAC name of 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride (CID 13076451) is 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride.
What is the SMILES notation for 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride?
The canonical SMILES for 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride is C=CCN1CCC(c2noc3ccccc23)CC1.Cl.
What is the InChIKey of 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride?
The InChIKey is XJLHPZCWMVWAQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O.ClH/c1-2-9-17-10-7-12(8-11-17)15-13-5-3-4-6-14(13)18-16-15;/h2-6,12H,1,7-11H2;1H.
What are the key properties of 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride?
3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride has a molecular weight of 278.78 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-prop-2-enylpiperidin-4-yl)-1,2-benzoxazole;hydrochloride is sourced from PubChem (CID 13076451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).