C22H21FN2O2 — CID 70468999
4-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]-1-(4-fluorophenyl)but-2-en-1-one (PubChem CID 70468999) has the molecular formula C22H21FN2O2 and a molecular weight of 364.42 g/mol. Its IUPAC name is 4-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]-1-(4-fluorophenyl)but-2-en-1-one.
| Compound Name | 4-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]-1-(4-fluorophenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 70468999 |
| Molecular Formula | C22H21FN2O2 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 4-[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]-1-(4-fluorophenyl)but-2-en-1-one |
| SMILES | O=C(C=CCN1CCC(c2noc3ccccc23)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN2O2/c23-18-9-7-16(8-10-18)20(26)5-3-13-25-14-11-17(12-15-25)22-19-4-1-2-6-21(19)27-24-22/h1-10,17H,11-15H2 |
| InChIKey | LXETWSPNEDHJAN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|