C28H36FN3O9 — CID 67070997
bis(but-2-enedioic acid);6-fluoro-3-[1-(3-piperidin-1-ylpropyl)piperidin-4-yl]-1,2-benzoxazole (PubChem CID 67070997) has the molecular formula C28H36FN3O9 and a molecular weight of 577.61 g/mol. Its IUPAC name is bis(but-2-enedioic acid);6-fluoro-3-[1-(3-piperidin-1-ylpropyl)piperidin-4-yl]-1,2-benzoxazole.
| Compound Name | bis(but-2-enedioic acid);6-fluoro-3-[1-(3-piperidin-1-ylpropyl)piperidin-4-yl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 67070997 |
| Molecular Formula | C28H36FN3O9 |
| Molecular Weight | 577.61 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | bis(but-2-enedioic acid);6-fluoro-3-[1-(3-piperidin-1-ylpropyl)piperidin-4-yl]-1,2-benzoxazole |
| SMILES | Fc1ccc2c(C3CCN(CCCN4CCCCC4)CC3)noc2c1.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C20H28FN3O.2C4H4O4/c21-17-5-6-18-19(15-17)25-22-20(18)16-7-13-24(14-8-16)12-4-11-23-9-2-1-3-10-23;2*5-3(6)1-2-4(7)8/h5-6,15-16H,1-4,7-14H2;2*1-2H,(H,5,6)(H,7,8) |
| InChIKey | JADHYTHQWDJYDC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 181.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|