C25H32FN3O3 — CID 14576395
8-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 14576395) has the molecular formula C25H32FN3O3 and a molecular weight of 441.55 g/mol. Its IUPAC name is 8-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 14576395 |
| Molecular Formula | C25H32FN3O3 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 8-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | O=C1CC2(CCCC2)CC(=O)N1CCCCN1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C25H32FN3O3/c26-19-5-6-20-21(15-19)32-27-24(20)18-7-13-28(14-8-18)11-3-4-12-29-22(30)16-25(17-23(29)31)9-1-2-10-25/h5-6,15,18H,1-4,7-14,16-17H2 |
| InChIKey | UFFGNTCFSXCDDW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|