C31H32FN3O3 — CID 71500717
1-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-4-naphthalen-1-ylpiperidine-2,6-dione (PubChem CID 71500717) has the molecular formula C31H32FN3O3 and a molecular weight of 513.61 g/mol. Its IUPAC name is 1-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-4-naphthalen-1-ylpiperidine-2,6-dione.
| Compound Name | 1-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-4-naphthalen-1-ylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 71500717 |
| Molecular Formula | C31H32FN3O3 |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 1-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]-4-naphthalen-1-ylpiperidine-2,6-dione |
| SMILES | O=C1CC(c2cccc3ccccc23)CC(=O)N1CCCCN1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C31H32FN3O3/c32-24-10-11-27-28(20-24)38-33-31(27)22-12-16-34(17-13-22)14-3-4-15-35-29(36)18-23(19-30(35)37)26-9-5-7-21-6-1-2-8-25(21)26/h1-2,5-11,20,22-23H,3-4,12-19H2 |
| InChIKey | KLMIDSQKIQMGNL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|