C24H24FN3O3 — CID 67655716
4-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]isoindole-1,3-dione (PubChem CID 67655716) has the molecular formula C24H24FN3O3 and a molecular weight of 421.47 g/mol. Its IUPAC name is 4-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 4-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67655716 |
| Molecular Formula | C24H24FN3O3 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 4-[4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]butyl]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c(CCCCN3CCC(c4noc5cc(F)ccc45)CC3)cccc21 |
| InChI | InChI=1S/C24H24FN3O3/c25-17-7-8-18-20(14-17)31-27-22(18)16-9-12-28(13-10-16)11-2-1-4-15-5-3-6-19-21(15)24(30)26-23(19)29/h3,5-8,14,16H,1-2,4,9-13H2,(H,26,29,30) |
| InChIKey | XIVNTKOZNAMCDQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|