C22H20FN3O4 — CID 131719738
4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]isoindole-1,3-dione (PubChem CID 131719738) has the molecular formula C22H20FN3O4 and a molecular weight of 409.42 g/mol. Its IUPAC name is 4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]isoindole-1,3-dione.
| Compound Name | 4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 131719738 |
| Molecular Formula | C22H20FN3O4 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 4-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethoxy]isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2c(OCCN3CCC(c4noc5cc(F)ccc45)CC3)cccc21 |
| InChI | InChI=1S/C22H20FN3O4/c23-14-4-5-15-18(12-14)30-25-20(15)13-6-8-26(9-7-13)10-11-29-17-3-1-2-16-19(17)22(28)24-21(16)27/h1-5,12-13H,6-11H2,(H,24,27,28) |
| InChIKey | BOQBOMJTIGPDLV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|