C23H27FN2O4 — CID 19599785
3-[1-[3-(2,3-dimethoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole (PubChem CID 19599785) has the molecular formula C23H27FN2O4 and a molecular weight of 414.48 g/mol. Its IUPAC name is 3-[1-[3-(2,3-dimethoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole.
| Compound Name | 3-[1-[3-(2,3-dimethoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole |
|---|---|
| PubChem CID | 19599785 |
| Molecular Formula | C23H27FN2O4 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 3-[1-[3-(2,3-dimethoxyphenoxy)propyl]piperidin-4-yl]-6-fluoro-1,2-benzoxazole |
| SMILES | COc1cccc(OCCCN2CCC(c3noc4cc(F)ccc34)CC2)c1OC |
| InChI | InChI=1S/C23H27FN2O4/c1-27-19-5-3-6-20(23(19)28-2)29-14-4-11-26-12-9-16(10-13-26)22-18-8-7-17(24)15-21(18)30-25-22/h3,5-8,15-16H,4,9-14H2,1-2H3 |
| InChIKey | BUEIMTLYUKGCTG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 56.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|