C24H29FN2O4 — CID 146270084
[4-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-(methoxymethyl)phenyl]methanol (PubChem CID 146270084) has the molecular formula C24H29FN2O4 and a molecular weight of 428.50 g/mol. Its IUPAC name is [4-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-(methoxymethyl)phenyl]methanol.
| Compound Name | [4-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-(methoxymethyl)phenyl]methanol |
|---|---|
| PubChem CID | 146270084 |
| Molecular Formula | C24H29FN2O4 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | [4-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-(methoxymethyl)phenyl]methanol |
| SMILES | COCc1cc(CO)ccc1OCCCN1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C24H29FN2O4/c1-29-16-19-13-17(15-28)3-6-22(19)30-12-2-9-27-10-7-18(8-11-27)24-21-5-4-20(25)14-23(21)31-26-24/h3-6,13-14,18,28H,2,7-12,15-16H2,1H3 |
| InChIKey | VDYQTABNHCWYTJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|