C23H27FN2O3 — CID 140530485
6-fluoro-3-[1-[3-[4-(methoxymethyl)phenoxy]propyl]piperidin-4-yl]-1,2-benzoxazole (PubChem CID 140530485) has the molecular formula C23H27FN2O3 and a molecular weight of 398.48 g/mol. Its IUPAC name is 6-fluoro-3-[1-[3-[4-(methoxymethyl)phenoxy]propyl]piperidin-4-yl]-1,2-benzoxazole.
| Compound Name | 6-fluoro-3-[1-[3-[4-(methoxymethyl)phenoxy]propyl]piperidin-4-yl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 140530485 |
| Molecular Formula | C23H27FN2O3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 6-fluoro-3-[1-[3-[4-(methoxymethyl)phenoxy]propyl]piperidin-4-yl]-1,2-benzoxazole |
| SMILES | COCc1ccc(OCCCN2CCC(c3noc4cc(F)ccc34)CC2)cc1 |
| InChI | InChI=1S/C23H27FN2O3/c1-27-16-17-3-6-20(7-4-17)28-14-2-11-26-12-9-18(10-13-26)23-21-8-5-19(24)15-22(21)29-25-23/h3-8,15,18H,2,9-14,16H2,1H3 |
| InChIKey | DIWDVLYCOMKFBY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|