C25H31FN2O3 — CID 23373628
6-fluoro-3-[1-[3-(2-methoxy-4-propylphenoxy)propyl]piperidin-4-yl]-1,2-benzoxazole (PubChem CID 23373628) has the molecular formula C25H31FN2O3 and a molecular weight of 426.53 g/mol. Its IUPAC name is 6-fluoro-3-[1-[3-(2-methoxy-4-propylphenoxy)propyl]piperidin-4-yl]-1,2-benzoxazole.
| Compound Name | 6-fluoro-3-[1-[3-(2-methoxy-4-propylphenoxy)propyl]piperidin-4-yl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 23373628 |
| Molecular Formula | C25H31FN2O3 |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 6-fluoro-3-[1-[3-(2-methoxy-4-propylphenoxy)propyl]piperidin-4-yl]-1,2-benzoxazole |
| SMILES | CCCc1ccc(OCCCN2CCC(c3noc4cc(F)ccc34)CC2)c(OC)c1 |
| InChI | InChI=1S/C25H31FN2O3/c1-3-5-18-6-9-22(24(16-18)29-2)30-15-4-12-28-13-10-19(11-14-28)25-21-8-7-20(26)17-23(21)31-27-25/h6-9,16-17,19H,3-5,10-15H2,1-2H3 |
| InChIKey | ZAIKMEKLSUMDGW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|