C29H29FN2O4 — CID 67636151
[2-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methoxyphenyl]-phenylmethanone (PubChem CID 67636151) has the molecular formula C29H29FN2O4 and a molecular weight of 488.56 g/mol. Its IUPAC name is [2-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methoxyphenyl]-phenylmethanone.
| Compound Name | [2-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methoxyphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 67636151 |
| Molecular Formula | C29H29FN2O4 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | [2-[3-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]propoxy]-3-methoxyphenyl]-phenylmethanone |
| SMILES | COc1cccc(C(=O)c2ccccc2)c1OCCCN1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C29H29FN2O4/c1-34-25-10-5-9-24(28(33)21-7-3-2-4-8-21)29(25)35-18-6-15-32-16-13-20(14-17-32)27-23-12-11-22(30)19-26(23)36-31-27/h2-5,7-12,19-20H,6,13-18H2,1H3 |
| InChIKey | KXWVPSWYMAKEHW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|