C23H23ClFN3O4 — CID 67559349
5-ethyl-6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-4-methoxyisoindole-1,3-dione;hydrochloride (PubChem CID 67559349) has the molecular formula C23H23ClFN3O4 and a molecular weight of 459.91 g/mol. Its IUPAC name is 5-ethyl-6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-4-methoxyisoindole-1,3-dione;hydrochloride.
| Compound Name | 5-ethyl-6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-4-methoxyisoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 67559349 |
| Molecular Formula | C23H23ClFN3O4 |
| Molecular Weight | 459.91 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 5-ethyl-6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-4-methoxyisoindole-1,3-dione;hydrochloride |
| SMILES | CCc1c(N2CCC(c3noc4cc(F)ccc34)CC2)cc2c(c1OC)C(=O)NC2=O.Cl |
| InChI | InChI=1S/C23H22FN3O4.ClH/c1-3-14-17(11-16-19(21(14)30-2)23(29)25-22(16)28)27-8-6-12(7-9-27)20-15-5-4-13(24)10-18(15)31-26-20;/h4-5,10-12H,3,6-9H2,1-2H3,(H,25,28,29);1H |
| InChIKey | ZIWHFKBGMDVZCJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.91 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|