C26H23FN4O9 — CID 67558933
(E)-but-2-enedioic acid;5-ethyl-6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-4-nitroisoindole-1,3-dione (PubChem CID 67558933) has the molecular formula C26H23FN4O9 and a molecular weight of 554.49 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;5-ethyl-6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-4-nitroisoindole-1,3-dione.
| Compound Name | (E)-but-2-enedioic acid;5-ethyl-6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 67558933 |
| Molecular Formula | C26H23FN4O9 |
| Molecular Weight | 554.49 g/mol |
| Exact Mass | 554.14 |
| IUPAC Name | (E)-but-2-enedioic acid;5-ethyl-6-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-4-nitroisoindole-1,3-dione |
| SMILES | CCc1c(N2CCC(c3noc4cc(F)ccc34)CC2)cc2c(c1[N+](=O)[O-])C(=O)NC2=O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H19FN4O5.C4H4O4/c1-2-13-16(10-15-18(20(13)27(30)31)22(29)24-21(15)28)26-7-5-11(6-8-26)19-14-4-3-12(23)9-17(14)32-25-19;5-3(6)1-2-4(7)8/h3-4,9-11H,2,5-8H2,1H3,(H,24,28,29);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | CZXKBJKLUSZDQC-WLHGVMLRSA-N |
| XLogP | 3.42 |
| TPSA | 193.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|