C26H25FN4O7 — CID 67071085
5-amino-2-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]isoindole-1,3-dione;but-2-enedioic acid (PubChem CID 67071085) has the molecular formula C26H25FN4O7 and a molecular weight of 524.51 g/mol. Its IUPAC name is 5-amino-2-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]isoindole-1,3-dione;but-2-enedioic acid.
| Compound Name | 5-amino-2-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]isoindole-1,3-dione;but-2-enedioic acid |
|---|---|
| PubChem CID | 67071085 |
| Molecular Formula | C26H25FN4O7 |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | 5-amino-2-[2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]ethyl]isoindole-1,3-dione;but-2-enedioic acid |
| SMILES | Nc1ccc2c(c1)C(=O)N(CCN1CCC(c3noc4cc(F)ccc34)CC1)C2=O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C22H21FN4O3.C4H4O4/c23-14-1-3-17-19(11-14)30-25-20(17)13-5-7-26(8-6-13)9-10-27-21(28)16-4-2-15(24)12-18(16)22(27)29;5-3(6)1-2-4(7)8/h1-4,11-13H,5-10,24H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | FVVLUPGIPIVAGO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 167.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|