C34H28FN3O3 — CID 139959533
2-[[4-[4-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 139959533) has the molecular formula C34H28FN3O3 and a molecular weight of 545.61 g/mol. Its IUPAC name is 2-[[4-[4-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[4-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 139959533 |
| Molecular Formula | C34H28FN3O3 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 2-[[4-[4-[[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1ccc(-c2ccc(CN3CCC(c4noc5cc(F)ccc45)CC3)cc2)cc1 |
| InChI | InChI=1S/C34H28FN3O3/c35-27-13-14-30-31(19-27)41-36-32(30)26-15-17-37(18-16-26)20-22-5-9-24(10-6-22)25-11-7-23(8-12-25)21-38-33(39)28-3-1-2-4-29(28)34(38)40/h1-14,19,26H,15-18,20-21H2 |
| InChIKey | HLPYIAISBALYNW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|