C12H12ClFN2O — CID 89080294
3-(1-chloropiperidin-4-yl)-6-fluoro-1,2-benzoxazole (PubChem CID 89080294) has the molecular formula C12H12ClFN2O and a molecular weight of 254.69 g/mol. Its IUPAC name is 3-(1-chloropiperidin-4-yl)-6-fluoro-1,2-benzoxazole.
| Compound Name | 3-(1-chloropiperidin-4-yl)-6-fluoro-1,2-benzoxazole |
|---|---|
| PubChem CID | 89080294 |
| Molecular Formula | C12H12ClFN2O |
| Molecular Weight | 254.69 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 3-(1-chloropiperidin-4-yl)-6-fluoro-1,2-benzoxazole |
| SMILES | Fc1ccc2c(C3CCN(Cl)CC3)noc2c1 |
| InChI | InChI=1S/C12H12ClFN2O/c13-16-5-3-8(4-6-16)12-10-2-1-9(14)7-11(10)17-15-12/h1-2,7-8H,3-6H2 |
| InChIKey | XMOVSFJSCFWUMK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.69 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|