C16H15FN2O5 — CID 67070819
(Z)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]but-2-enedioic acid (PubChem CID 67070819) has the molecular formula C16H15FN2O5 and a molecular weight of 334.30 g/mol. Its IUPAC name is (Z)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]but-2-enedioic acid.
| Compound Name | (Z)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]but-2-enedioic acid |
|---|---|
| PubChem CID | 67070819 |
| Molecular Formula | C16H15FN2O5 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (Z)-2-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]but-2-enedioic acid |
| SMILES | O=C(O)/C=C(/C(=O)O)N1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C16H15FN2O5/c17-10-1-2-11-13(7-10)24-18-15(11)9-3-5-19(6-4-9)12(16(22)23)8-14(20)21/h1-2,7-9H,3-6H2,(H,20,21)(H,22,23)/b12-8- |
| InChIKey | IOLNLKUXZAZKIS-WQLSENKSSA-N |
| XLogP | 2.20 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|