C30H43FN2O2 — CID 175098735
(9E)-1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]octadeca-9,12-dien-1-one (PubChem CID 175098735) has the molecular formula C30H43FN2O2 and a molecular weight of 482.68 g/mol. Its IUPAC name is (9E)-1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]octadeca-9,12-dien-1-one.
| Compound Name | (9E)-1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]octadeca-9,12-dien-1-one |
|---|---|
| PubChem CID | 175098735 |
| Molecular Formula | C30H43FN2O2 |
| Molecular Weight | 482.68 g/mol |
| Exact Mass | 482.33 |
| IUPAC Name | (9E)-1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]octadeca-9,12-dien-1-one |
| SMILES | CCCCCC=CC/C=C/CCCCCCCC(=O)N1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C30H43FN2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-29(34)33-22-20-25(21-23-33)30-27-19-18-26(31)24-28(27)35-32-30/h6-7,9-10,18-19,24-25H,2-5,8,11-17,20-23H2,1H3/b7-6?,10-9+ |
| InChIKey | PLKUIDMZUFLQIY-VGAVRCOMSA-N |
| XLogP | 8.49 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.68 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|