C27H41FN2O3 — CID 67561214
[1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-methylbutyl] decanoate (PubChem CID 67561214) has the molecular formula C27H41FN2O3 and a molecular weight of 460.63 g/mol. Its IUPAC name is [1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-methylbutyl] decanoate.
| Compound Name | [1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-methylbutyl] decanoate |
|---|---|
| PubChem CID | 67561214 |
| Molecular Formula | C27H41FN2O3 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | [1-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]-2-methylbutyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC(C(C)CC)N1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C27H41FN2O3/c1-4-6-7-8-9-10-11-12-25(31)32-27(20(3)5-2)30-17-15-21(16-18-30)26-23-14-13-22(28)19-24(23)33-29-26/h13-14,19-21,27H,4-12,15-18H2,1-3H3 |
| InChIKey | JDOZWCOUSAVRCE-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|