C32H44FN4O5+ — CID 58337287
[4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(9-hydroxy-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl octanoate (PubChem CID 58337287) has the molecular formula C32H44FN4O5+ and a molecular weight of 583.73 g/mol. Its IUPAC name is [4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(9-hydroxy-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl octanoate.
| Compound Name | [4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(9-hydroxy-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl octanoate |
|---|---|
| PubChem CID | 58337287 |
| Molecular Formula | C32H44FN4O5+ |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.33 |
| IUPAC Name | [4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(9-hydroxy-2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OC[N+]1(CCc2c(C)nc3n(c2=O)CCCC3O)CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C32H44FN4O5/c1-3-4-5-6-7-10-29(39)41-21-37(19-15-25-22(2)34-31-27(38)9-8-16-36(31)32(25)40)17-13-23(14-18-37)30-26-12-11-24(33)20-28(26)42-35-30/h11-12,20,23,27,38H,3-10,13-19,21H2,1-2H3/q+1 |
| InChIKey | ZFUJOYIOEHBRQH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|