C32H37FN4O4 — CID 159584357
carbanide;[4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl benzoate (PubChem CID 159584357) has the molecular formula C32H37FN4O4 and a molecular weight of 560.67 g/mol. Its IUPAC name is carbanide;[4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl benzoate.
| Compound Name | carbanide;[4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 159584357 |
| Molecular Formula | C32H37FN4O4 |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | carbanide;[4-(6-fluoro-1,2-benzoxazol-3-yl)-1-[2-(2-methyl-4-oxo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-3-yl)ethyl]piperidin-1-ium-1-yl]methyl benzoate |
| SMILES | Cc1nc2n(c(=O)c1CC[N+]1(COC(=O)c3ccccc3)CCC(c3noc4cc(F)ccc34)CC1)CCCC2.[CH3-] |
| InChI | InChI=1S/C31H34FN4O4.CH3/c1-21-25(30(37)35-15-6-5-9-28(35)33-21)14-18-36(20-39-31(38)23-7-3-2-4-8-23)16-12-22(13-17-36)29-26-11-10-24(32)19-27(26)40-34-29;/h2-4,7-8,10-11,19,22H,5-6,9,12-18,20H2,1H3;1H3/q+1;-1 |
| InChIKey | KUCLUYKLKTXBAK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 87.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|